C17H24FN3O4S — CID 55992642
N-[3-(butan-2-ylamino)-3-oxopropyl]-4-fluoro-3-(prop-2-enylsulfamoyl)benzamide (PubChem CID 55992642) has the molecular formula C17H24FN3O4S and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[3-(butan-2-ylamino)-3-oxopropyl]-4-fluoro-3-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-4-fluoro-3-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55992642 |
| Molecular Formula | C17H24FN3O4S |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-4-fluoro-3-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1cc(C(=O)NCCC(=O)NC(C)CC)ccc1F |
| InChI | InChI=1S/C17H24FN3O4S/c1-4-9-20-26(24,25)15-11-13(6-7-14(15)18)17(23)19-10-8-16(22)21-12(3)5-2/h4,6-7,11-12,20H,1,5,8-10H2,2-3H3,(H,19,23)(H,21,22) |
| InChIKey | QHHUGWQZFKRWFO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|