C19H31N3O5S — CID 55948926
N-[3-(butan-2-ylamino)-3-oxopropyl]-3-(diethylsulfamoyl)-4-methoxybenzamide (PubChem CID 55948926) has the molecular formula C19H31N3O5S and a molecular weight of 413.54 g/mol. Its IUPAC name is N-[3-(butan-2-ylamino)-3-oxopropyl]-3-(diethylsulfamoyl)-4-methoxybenzamide.
| Compound Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-3-(diethylsulfamoyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 55948926 |
| Molecular Formula | C19H31N3O5S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-3-(diethylsulfamoyl)-4-methoxybenzamide |
| SMILES | CCC(C)NC(=O)CCNC(=O)c1ccc(OC)c(S(=O)(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C19H31N3O5S/c1-6-14(4)21-18(23)11-12-20-19(24)15-9-10-16(27-5)17(13-15)28(25,26)22(7-2)8-3/h9-10,13-14H,6-8,11-12H2,1-5H3,(H,20,24)(H,21,23) |
| InChIKey | KAGYUJSDIPFQKX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |