C22H30N2O6S — CID 43874005
3-(diethylsulfamoyl)-N-[1-(3,4-dimethoxyphenyl)ethyl]-4-methoxybenzamide (PubChem CID 43874005) has the molecular formula C22H30N2O6S and a molecular weight of 450.56 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-[1-(3,4-dimethoxyphenyl)ethyl]-4-methoxybenzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-[1-(3,4-dimethoxyphenyl)ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 43874005 |
| Molecular Formula | C22H30N2O6S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-[1-(3,4-dimethoxyphenyl)ethyl]-4-methoxybenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)NC(C)c2ccc(OC)c(OC)c2)ccc1OC |
| InChI | InChI=1S/C22H30N2O6S/c1-7-24(8-2)31(26,27)21-14-17(10-12-19(21)29-5)22(25)23-15(3)16-9-11-18(28-4)20(13-16)30-6/h9-15H,7-8H2,1-6H3,(H,23,25) |
| InChIKey | NTASUMHUOHDARH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |