C15H20N2O4S — CID 18109975
3-(diethylsulfamoyl)-4-methoxy-N-prop-2-ynylbenzamide (PubChem CID 18109975) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-4-methoxy-N-prop-2-ynylbenzamide.
| Compound Name | 3-(diethylsulfamoyl)-4-methoxy-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 18109975 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 3-(diethylsulfamoyl)-4-methoxy-N-prop-2-ynylbenzamide |
| SMILES | C#CCNC(=O)c1ccc(OC)c(S(=O)(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C15H20N2O4S/c1-5-10-16-15(18)12-8-9-13(21-4)14(11-12)22(19,20)17(6-2)7-3/h1,8-9,11H,6-7,10H2,2-4H3,(H,16,18) |
| InChIKey | YDLUXUSQGXQFKJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|