C17H23N3O4S — CID 49396788
3-(diethylsulfamoyl)-4-methyl-N-[2-oxo-2-(prop-2-ynylamino)ethyl]benzamide (PubChem CID 49396788) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-4-methyl-N-[2-oxo-2-(prop-2-ynylamino)ethyl]benzamide.
| Compound Name | 3-(diethylsulfamoyl)-4-methyl-N-[2-oxo-2-(prop-2-ynylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 49396788 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3-(diethylsulfamoyl)-4-methyl-N-[2-oxo-2-(prop-2-ynylamino)ethyl]benzamide |
| SMILES | C#CCNC(=O)CNC(=O)c1ccc(C)c(S(=O)(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C17H23N3O4S/c1-5-10-18-16(21)12-19-17(22)14-9-8-13(4)15(11-14)25(23,24)20(6-2)7-3/h1,8-9,11H,6-7,10,12H2,2-4H3,(H,18,21)(H,19,22) |
| InChIKey | FXVRKHFMICMSQW-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|