C16H28ClN3O3S — CID 119433491
3-(diethylsulfamoyl)-4-methyl-N-[3-(methylamino)propyl]benzamide;hydrochloride (PubChem CID 119433491) has the molecular formula C16H28ClN3O3S and a molecular weight of 377.94 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-4-methyl-N-[3-(methylamino)propyl]benzamide;hydrochloride.
| Compound Name | 3-(diethylsulfamoyl)-4-methyl-N-[3-(methylamino)propyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119433491 |
| Molecular Formula | C16H28ClN3O3S |
| Molecular Weight | 377.94 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 3-(diethylsulfamoyl)-4-methyl-N-[3-(methylamino)propyl]benzamide;hydrochloride |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)NCCCNC)ccc1C.Cl |
| InChI | InChI=1S/C16H27N3O3S.ClH/c1-5-19(6-2)23(21,22)15-12-14(9-8-13(15)3)16(20)18-11-7-10-17-4;/h8-9,12,17H,5-7,10-11H2,1-4H3,(H,18,20);1H |
| InChIKey | VUTMSBVOPNKZAB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.94 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|