C15H24N2O3S — CID 110295894
3-(dimethylsulfamoyl)-4-methyl-N-pentylbenzamide (PubChem CID 110295894) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-4-methyl-N-pentylbenzamide.
| Compound Name | 3-(dimethylsulfamoyl)-4-methyl-N-pentylbenzamide |
|---|---|
| PubChem CID | 110295894 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3-(dimethylsulfamoyl)-4-methyl-N-pentylbenzamide |
| SMILES | CCCCCNC(=O)c1ccc(C)c(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C15H24N2O3S/c1-5-6-7-10-16-15(18)13-9-8-12(2)14(11-13)21(19,20)17(3)4/h8-9,11H,5-7,10H2,1-4H3,(H,16,18) |
| InChIKey | ZRBKGHHPIQOVAL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|