C21H30N2O3S — CID 143631327
3-(diethylsulfamoyl)-4-methyl-N-[(2E,3Z)-2-propylidenehexa-3,5-dienyl]benzamide (PubChem CID 143631327) has the molecular formula C21H30N2O3S and a molecular weight of 390.55 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-4-methyl-N-[(2E,3Z)-2-propylidenehexa-3,5-dienyl]benzamide.
| Compound Name | 3-(diethylsulfamoyl)-4-methyl-N-[(2E,3Z)-2-propylidenehexa-3,5-dienyl]benzamide |
|---|---|
| PubChem CID | 143631327 |
| Molecular Formula | C21H30N2O3S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 3-(diethylsulfamoyl)-4-methyl-N-[(2E,3Z)-2-propylidenehexa-3,5-dienyl]benzamide |
| SMILES | C=C/C=C\C(=C/CC)CNC(=O)c1ccc(C)c(S(=O)(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C21H30N2O3S/c1-6-10-12-18(11-7-2)16-22-21(24)19-14-13-17(5)20(15-19)27(25,26)23(8-3)9-4/h6,10-15H,1,7-9,16H2,2-5H3,(H,22,24)/b12-10-,18-11+ |
| InChIKey | DVJWHLCVGAZESA-KPGOJGKGSA-N |
| XLogP | 3.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|