C17H28N2O3S — CID 134006059
N-butan-2-yl-3-(diethylsulfamoyl)-N,4-dimethylbenzamide (PubChem CID 134006059) has the molecular formula C17H28N2O3S and a molecular weight of 340.49 g/mol. Its IUPAC name is N-butan-2-yl-3-(diethylsulfamoyl)-N,4-dimethylbenzamide.
| Compound Name | N-butan-2-yl-3-(diethylsulfamoyl)-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 134006059 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-butan-2-yl-3-(diethylsulfamoyl)-N,4-dimethylbenzamide |
| SMILES | CCC(C)N(C)C(=O)c1ccc(C)c(S(=O)(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C17H28N2O3S/c1-7-14(5)18(6)17(20)15-11-10-13(4)16(12-15)23(21,22)19(8-2)9-3/h10-12,14H,7-9H2,1-6H3 |
| InChIKey | NWCMSQLFWCZUBA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |