C17H26N2O6S — CID 119189513
2-[[3-(diethylsulfamoyl)-4-methylbenzoyl]-(2-methoxyethyl)amino]acetic acid (PubChem CID 119189513) has the molecular formula C17H26N2O6S and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-[[3-(diethylsulfamoyl)-4-methylbenzoyl]-(2-methoxyethyl)amino]acetic acid.
| Compound Name | 2-[[3-(diethylsulfamoyl)-4-methylbenzoyl]-(2-methoxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 119189513 |
| Molecular Formula | C17H26N2O6S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-[[3-(diethylsulfamoyl)-4-methylbenzoyl]-(2-methoxyethyl)amino]acetic acid |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)N(CCOC)CC(=O)O)ccc1C |
| InChI | InChI=1S/C17H26N2O6S/c1-5-19(6-2)26(23,24)15-11-14(8-7-13(15)3)17(22)18(9-10-25-4)12-16(20)21/h7-8,11H,5-6,9-10,12H2,1-4H3,(H,20,21) |
| InChIKey | SXEMZCKJWFWKIK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |