C14H20N2O6S — CID 119189349
2-[[3-(methanesulfonamido)-4-methylbenzoyl]-(2-methoxyethyl)amino]acetic acid (PubChem CID 119189349) has the molecular formula C14H20N2O6S and a molecular weight of 344.39 g/mol. Its IUPAC name is 2-[[3-(methanesulfonamido)-4-methylbenzoyl]-(2-methoxyethyl)amino]acetic acid.
| Compound Name | 2-[[3-(methanesulfonamido)-4-methylbenzoyl]-(2-methoxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 119189349 |
| Molecular Formula | C14H20N2O6S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-[[3-(methanesulfonamido)-4-methylbenzoyl]-(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)c1ccc(C)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H20N2O6S/c1-10-4-5-11(8-12(10)15-23(3,20)21)14(19)16(6-7-22-2)9-13(17)18/h4-5,8,15H,6-7,9H2,1-3H3,(H,17,18) |
| InChIKey | UZNWXBZGTNGBMD-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |