C15H24N2O3S — CID 134062114
3-(methanesulfonamido)-4-methyl-N,N-dipropylbenzamide (PubChem CID 134062114) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 3-(methanesulfonamido)-4-methyl-N,N-dipropylbenzamide.
| Compound Name | 3-(methanesulfonamido)-4-methyl-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 134062114 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3-(methanesulfonamido)-4-methyl-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(C)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H24N2O3S/c1-5-9-17(10-6-2)15(18)13-8-7-12(3)14(11-13)16-21(4,19)20/h7-8,11,16H,5-6,9-10H2,1-4H3 |
| InChIKey | ZIOXOWKIVFTHJI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |