C19H32N2O — CID 143307658
4-methyl-3-[[methyl(propyl)amino]methyl]-N,N-dipropylbenzamide (PubChem CID 143307658) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is 4-methyl-3-[[methyl(propyl)amino]methyl]-N,N-dipropylbenzamide.
| Compound Name | 4-methyl-3-[[methyl(propyl)amino]methyl]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 143307658 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | 4-methyl-3-[[methyl(propyl)amino]methyl]-N,N-dipropylbenzamide |
| SMILES | CCCN(C)Cc1cc(C(=O)N(CCC)CCC)ccc1C |
| InChI | InChI=1S/C19H32N2O/c1-6-11-20(5)15-18-14-17(10-9-16(18)4)19(22)21(12-7-2)13-8-3/h9-10,14H,6-8,11-13,15H2,1-5H3 |
| InChIKey | VUDSPMGSHWXVQM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |