C22H30N2O3S — CID 26555928
3-(diethylsulfamoyl)-N-[(4-ethylphenyl)methyl]-N,4-dimethylbenzamide (PubChem CID 26555928) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-[(4-ethylphenyl)methyl]-N,4-dimethylbenzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-[(4-ethylphenyl)methyl]-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 26555928 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-[(4-ethylphenyl)methyl]-N,4-dimethylbenzamide |
| SMILES | CCc1ccc(CN(C)C(=O)c2ccc(C)c(S(=O)(=O)N(CC)CC)c2)cc1 |
| InChI | InChI=1S/C22H30N2O3S/c1-6-18-10-12-19(13-11-18)16-23(5)22(25)20-14-9-17(4)21(15-20)28(26,27)24(7-2)8-3/h9-15H,6-8,16H2,1-5H3 |
| InChIKey | GOERYAWXAYKPCF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |