C20H34N2O4S — CID 71864150
3-(diethylsulfamoyl)-N-[2-(2-hydroxyethyl)-4-methylpentyl]-4-methylbenzamide (PubChem CID 71864150) has the molecular formula C20H34N2O4S and a molecular weight of 398.57 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-[2-(2-hydroxyethyl)-4-methylpentyl]-4-methylbenzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-[2-(2-hydroxyethyl)-4-methylpentyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 71864150 |
| Molecular Formula | C20H34N2O4S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-[2-(2-hydroxyethyl)-4-methylpentyl]-4-methylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)NCC(CCO)CC(C)C)ccc1C |
| InChI | InChI=1S/C20H34N2O4S/c1-6-22(7-2)27(25,26)19-13-18(9-8-16(19)5)20(24)21-14-17(10-11-23)12-15(3)4/h8-9,13,15,17,23H,6-7,10-12,14H2,1-5H3,(H,21,24) |
| InChIKey | SEXIKCFGYAFDBB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |