C18H28N2O5S — CID 120614682
(2S)-2-[[3-(diethylsulfamoyl)-4-methylbenzoyl]amino]hexanoic acid (PubChem CID 120614682) has the molecular formula C18H28N2O5S and a molecular weight of 384.50 g/mol. Its IUPAC name is (2S)-2-[[3-(diethylsulfamoyl)-4-methylbenzoyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[3-(diethylsulfamoyl)-4-methylbenzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 120614682 |
| Molecular Formula | C18H28N2O5S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (2S)-2-[[3-(diethylsulfamoyl)-4-methylbenzoyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)c1ccc(C)c(S(=O)(=O)N(CC)CC)c1)C(=O)O |
| InChI | InChI=1S/C18H28N2O5S/c1-5-8-9-15(18(22)23)19-17(21)14-11-10-13(4)16(12-14)26(24,25)20(6-2)7-3/h10-12,15H,5-9H2,1-4H3,(H,19,21)(H,22,23)/t15-/m0/s1 |
| InChIKey | IKABIQCSOQTYLY-HNNXBMFYSA-N |
| XLogP | 2.40 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |