C21H35N3O5S — CID 46432510
ethyl N-[1-[[3-(diethylsulfamoyl)-4-methylbenzoyl]amino]-4-methylpentan-2-yl]carbamate (PubChem CID 46432510) has the molecular formula C21H35N3O5S and a molecular weight of 441.59 g/mol. Its IUPAC name is ethyl N-[1-[[3-(diethylsulfamoyl)-4-methylbenzoyl]amino]-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[[3-(diethylsulfamoyl)-4-methylbenzoyl]amino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 46432510 |
| Molecular Formula | C21H35N3O5S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | ethyl N-[1-[[3-(diethylsulfamoyl)-4-methylbenzoyl]amino]-4-methylpentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CNC(=O)c1ccc(C)c(S(=O)(=O)N(CC)CC)c1)CC(C)C |
| InChI | InChI=1S/C21H35N3O5S/c1-7-24(8-2)30(27,28)19-13-17(11-10-16(19)6)20(25)22-14-18(12-15(4)5)23-21(26)29-9-3/h10-11,13,15,18H,7-9,12,14H2,1-6H3,(H,22,25)(H,23,26) |
| InChIKey | WZCJCPINOQMFBI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |