C21H26N2O6S — CID 18159614
N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(diethylsulfamoyl)-4-methoxybenzamide (PubChem CID 18159614) has the molecular formula C21H26N2O6S and a molecular weight of 434.51 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(diethylsulfamoyl)-4-methoxybenzamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(diethylsulfamoyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 18159614 |
| Molecular Formula | C21H26N2O6S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(diethylsulfamoyl)-4-methoxybenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)NCCc2ccc3c(c2)OCO3)ccc1OC |
| InChI | InChI=1S/C21H26N2O6S/c1-4-23(5-2)30(25,26)20-13-16(7-9-18(20)27-3)21(24)22-11-10-15-6-8-17-19(12-15)29-14-28-17/h6-9,12-13H,4-5,10-11,14H2,1-3H3,(H,22,24) |
| InChIKey | OMMLBDZQZWMQGS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |