C19H21NO6 — CID 113095660
N-[2-(3,4,5-trimethoxyphenyl)ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 113095660) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is N-[2-(3,4,5-trimethoxyphenyl)ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-(3,4,5-trimethoxyphenyl)ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 113095660 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N-[2-(3,4,5-trimethoxyphenyl)ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1cc(CCNC(=O)c2ccc3c(c2)OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C19H21NO6/c1-22-16-8-12(9-17(23-2)18(16)24-3)6-7-20-19(21)13-4-5-14-15(10-13)26-11-25-14/h4-5,8-10H,6-7,11H2,1-3H3,(H,20,21) |
| InChIKey | GELARTLJUFQYNS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |