C15H20N2O6 — CID 108542972
N-[2-[[2-(2-methoxyethoxy)acetyl]amino]ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 108542972) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is N-[2-[[2-(2-methoxyethoxy)acetyl]amino]ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[[2-(2-methoxyethoxy)acetyl]amino]ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 108542972 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | N-[2-[[2-(2-methoxyethoxy)acetyl]amino]ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | COCCOCC(=O)NCCNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H20N2O6/c1-20-6-7-21-9-14(18)16-4-5-17-15(19)11-2-3-12-13(8-11)23-10-22-12/h2-3,8H,4-7,9-10H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | ZFDIBHANQBKTEN-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|