C12H14BrNO4 — CID 114309908
N-(2-bromo-3-methoxypropyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 114309908) has the molecular formula C12H14BrNO4 and a molecular weight of 316.15 g/mol. Its IUPAC name is N-(2-bromo-3-methoxypropyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(2-bromo-3-methoxypropyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 114309908 |
| Molecular Formula | C12H14BrNO4 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | N-(2-bromo-3-methoxypropyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | COCC(Br)CNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H14BrNO4/c1-16-6-9(13)5-14-12(15)8-2-3-10-11(4-8)18-7-17-10/h2-4,9H,5-7H2,1H3,(H,14,15) |
| InChIKey | DDLLEWJVIYKLBM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|