C14H19NO4 — CID 103771408
N-(2-hydroxy-4-methylpentyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 103771408) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-(2-hydroxy-4-methylpentyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(2-hydroxy-4-methylpentyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 103771408 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N-(2-hydroxy-4-methylpentyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(C)CC(O)CNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H19NO4/c1-9(2)5-11(16)7-15-14(17)10-3-4-12-13(6-10)19-8-18-12/h3-4,6,9,11,16H,5,7-8H2,1-2H3,(H,15,17) |
| InChIKey | OIMNVPRAJVYLRJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |