C14H17NO5 — CID 81064781
3-[(1,3-benzodioxole-5-carbonylamino)methyl]pentanoic acid (PubChem CID 81064781) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 3-[(1,3-benzodioxole-5-carbonylamino)methyl]pentanoic acid.
| Compound Name | 3-[(1,3-benzodioxole-5-carbonylamino)methyl]pentanoic acid |
|---|---|
| PubChem CID | 81064781 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 3-[(1,3-benzodioxole-5-carbonylamino)methyl]pentanoic acid |
| SMILES | CCC(CNC(=O)c1ccc2c(c1)OCO2)CC(=O)O |
| InChI | InChI=1S/C14H17NO5/c1-2-9(5-13(16)17)7-15-14(18)10-3-4-11-12(6-10)20-8-19-11/h3-4,6,9H,2,5,7-8H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | ZGEYYHDWBNEMJD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |