C17H26N2O4 — CID 108574844
N-[2-[[2-(2-methoxyethoxy)acetyl]amino]ethyl]-4-propan-2-ylbenzamide (PubChem CID 108574844) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[2-[[2-(2-methoxyethoxy)acetyl]amino]ethyl]-4-propan-2-ylbenzamide.
| Compound Name | N-[2-[[2-(2-methoxyethoxy)acetyl]amino]ethyl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 108574844 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | N-[2-[[2-(2-methoxyethoxy)acetyl]amino]ethyl]-4-propan-2-ylbenzamide |
| SMILES | COCCOCC(=O)NCCNC(=O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C17H26N2O4/c1-13(2)14-4-6-15(7-5-14)17(21)19-9-8-18-16(20)12-23-11-10-22-3/h4-7,13H,8-12H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | ZZUFFIKDYUYSHD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|