C19H29N3O4 — CID 108570352
tert-butyl N-[2-oxo-2-[2-[(4-propan-2-ylbenzoyl)amino]ethylamino]ethyl]carbamate (PubChem CID 108570352) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[2-[(4-propan-2-ylbenzoyl)amino]ethylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[2-[(4-propan-2-ylbenzoyl)amino]ethylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 108570352 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[2-[(4-propan-2-ylbenzoyl)amino]ethylamino]ethyl]carbamate |
| SMILES | CC(C)c1ccc(C(=O)NCCNC(=O)CNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H29N3O4/c1-13(2)14-6-8-15(9-7-14)17(24)21-11-10-20-16(23)12-22-18(25)26-19(3,4)5/h6-9,13H,10-12H2,1-5H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | KOAAFHULQCLFCH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|