C19H29N3O7 — CID 108916210
tert-butyl N-[2-oxo-2-[2-[(3,4,5-trimethoxybenzoyl)amino]ethylamino]ethyl]carbamate (PubChem CID 108916210) has the molecular formula C19H29N3O7 and a molecular weight of 411.46 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[2-[(3,4,5-trimethoxybenzoyl)amino]ethylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[2-[(3,4,5-trimethoxybenzoyl)amino]ethylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 108916210 |
| Molecular Formula | C19H29N3O7 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[2-[(3,4,5-trimethoxybenzoyl)amino]ethylamino]ethyl]carbamate |
| SMILES | COc1cc(C(=O)NCCNC(=O)CNC(=O)OC(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C19H29N3O7/c1-19(2,3)29-18(25)22-11-15(23)20-7-8-21-17(24)12-9-13(26-4)16(28-6)14(10-12)27-5/h9-10H,7-8,11H2,1-6H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | KUHYALLZFXOWSO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|