C18H28N4O5 — CID 90278399
4-amino-N-[2-[[2-[2-[2-(propanoylamino)ethoxy]ethoxy]acetyl]amino]ethyl]benzamide (PubChem CID 90278399) has the molecular formula C18H28N4O5 and a molecular weight of 380.45 g/mol. Its IUPAC name is 4-amino-N-[2-[[2-[2-[2-(propanoylamino)ethoxy]ethoxy]acetyl]amino]ethyl]benzamide.
| Compound Name | 4-amino-N-[2-[[2-[2-[2-(propanoylamino)ethoxy]ethoxy]acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 90278399 |
| Molecular Formula | C18H28N4O5 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 4-amino-N-[2-[[2-[2-[2-(propanoylamino)ethoxy]ethoxy]acetyl]amino]ethyl]benzamide |
| SMILES | CCC(=O)NCCOCCOCC(=O)NCCNC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C18H28N4O5/c1-2-16(23)21-9-10-26-11-12-27-13-17(24)20-7-8-22-18(25)14-3-5-15(19)6-4-14/h3-6H,2,7-13,19H2,1H3,(H,20,24)(H,21,23)(H,22,25) |
| InChIKey | ICVFONYGDFJZIV-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|