C13H16N2O3 — CID 118056637
2-[(4-aminobenzoyl)amino]ethyl 2-methylprop-2-enoate (PubChem CID 118056637) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-[(4-aminobenzoyl)amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(4-aminobenzoyl)amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118056637 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-[(4-aminobenzoyl)amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C13H16N2O3/c1-9(2)13(17)18-8-7-15-12(16)10-3-5-11(14)6-4-10/h3-6H,1,7-8,14H2,2H3,(H,15,16) |
| InChIKey | NMRIQCOTDXBLPB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|