About 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen
4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen (PubChem CID 156799285) has the molecular formula C13H28N2O2
and a molecular weight of 244.38 g/mol. Its IUPAC name is 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen |
| PubChem CID | 156799285 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen |
| SMILES | CC.CC.Nc1ccc(C(=O)NCCO)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C9H12N2O2.2C2H6.2H2/c10-8-3-1-7(2-4-8)9(13)11-5-6-12;2*1-2;;/h1-4,12H,5-6,10H2,(H,11,13);2*1-2H3;2*1H |
| InChIKey | OLXDSEJHUVWIFD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen?
The IUPAC name of 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen (CID 156799285) is 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen.
What is the SMILES notation for 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen?
The canonical SMILES for 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen is CC.CC.Nc1ccc(C(=O)NCCO)cc1.[H][H].[H][H].
What is the InChIKey of 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen?
The InChIKey is OLXDSEJHUVWIFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2.2C2H6.2H2/c10-8-3-1-7(2-4-8)9(13)11-5-6-12;2*1-2;;/h1-4,12H,5-6,10H2,(H,11,13);2*1-2H3;2*1H.
What are the key properties of 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen?
4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen has a molecular weight of 244.38 g/mol, XLogP of 2.54, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen is sourced from PubChem (CID 156799285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).