4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen

C13H28N2O2 — CID 156799285

IUPAC4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen
SMILESCC.CC.Nc1ccc(C(=O)NCCO)cc1.[H][H].[H][H]
InChIInChI=1S/C9H12N2O2.2C2H6.2H2/c10-8-3-1-7(2-4-8)9(13)11-5-6-12;2*1-2;;/h1-4,12H,5-6,10H2,(H,11,13);2*1-2H3;2*1H
InChIKeyOLXDSEJHUVWIFD-UHFFFAOYSA-N
MW244.38 g/mol
LogP2.54
Rot. Bonds3

About 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen

4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen (PubChem CID 156799285) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen.

Molecular Properties

Compound Name4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen
PubChem CID156799285
Molecular FormulaC13H28N2O2
Molecular Weight244.38 g/mol
Exact Mass244.22
IUPAC Name4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen
SMILESCC.CC.Nc1ccc(C(=O)NCCO)cc1.[H][H].[H][H]
InChIInChI=1S/C9H12N2O2.2C2H6.2H2/c10-8-3-1-7(2-4-8)9(13)11-5-6-12;2*1-2;;/h1-4,12H,5-6,10H2,(H,11,13);2*1-2H3;2*1H
InChIKeyOLXDSEJHUVWIFD-UHFFFAOYSA-N
XLogP2.54
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.38
LogP ≤ 52.54
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen?
The IUPAC name of 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen (CID 156799285) is 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen.
What is the SMILES notation for 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen?
The canonical SMILES for 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen is CC.CC.Nc1ccc(C(=O)NCCO)cc1.[H][H].[H][H].
What is the InChIKey of 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen?
The InChIKey is OLXDSEJHUVWIFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2.2C2H6.2H2/c10-8-3-1-7(2-4-8)9(13)11-5-6-12;2*1-2;;/h1-4,12H,5-6,10H2,(H,11,13);2*1-2H3;2*1H.
What are the key properties of 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen?
4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen has a molecular weight of 244.38 g/mol, XLogP of 2.54, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(2-hydroxyethyl)benzamide;ethane;molecular hydrogen is sourced from PubChem (CID 156799285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).