About 2-(carbonochloridoylamino)ethyl 2-methylprop-2-enoate
2-(carbonochloridoylamino)ethyl 2-methylprop-2-enoate (PubChem CID 18000331) has the molecular formula C7H10ClNO3
and a molecular weight of 191.61 g/mol. Its IUPAC name is 2-(carbonochloridoylamino)ethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 2-(carbonochloridoylamino)ethyl 2-methylprop-2-enoate |
| PubChem CID | 18000331 |
| Molecular Formula | C7H10ClNO3 |
| Molecular Weight | 191.61 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 2-(carbonochloridoylamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)Cl |
| InChI | InChI=1S/C7H10ClNO3/c1-5(2)6(10)12-4-3-9-7(8)11/h1,3-4H2,2H3,(H,9,11) |
| InChIKey | GONKUPKTTHXYPQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.61 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-(carbonochloridoylamino)ethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(carbonochloridoylamino)ethyl 2-methylprop-2-enoate?
The IUPAC name of 2-(carbonochloridoylamino)ethyl 2-methylprop-2-enoate (CID 18000331) is 2-(carbonochloridoylamino)ethyl 2-methylprop-2-enoate.
What is the SMILES notation for 2-(carbonochloridoylamino)ethyl 2-methylprop-2-enoate?
The canonical SMILES for 2-(carbonochloridoylamino)ethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCNC(=O)Cl.
What is the InChIKey of 2-(carbonochloridoylamino)ethyl 2-methylprop-2-enoate?
The InChIKey is GONKUPKTTHXYPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClNO3/c1-5(2)6(10)12-4-3-9-7(8)11/h1,3-4H2,2H3,(H,9,11).
What are the key properties of 2-(carbonochloridoylamino)ethyl 2-methylprop-2-enoate?
2-(carbonochloridoylamino)ethyl 2-methylprop-2-enoate has a molecular weight of 191.61 g/mol, XLogP of 1.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(carbonochloridoylamino)ethyl 2-methylprop-2-enoate is sourced from PubChem (CID 18000331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).