C10H13NO3 — CID 134458425
2-(buta-2,3-dienoylamino)ethyl 2-methylprop-2-enoate (PubChem CID 134458425) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-(buta-2,3-dienoylamino)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(buta-2,3-dienoylamino)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134458425 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 2-(buta-2,3-dienoylamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C=CC(=O)NCCOC(=O)C(=C)C |
| InChI | InChI=1S/C10H13NO3/c1-4-5-9(12)11-6-7-14-10(13)8(2)3/h5H,1-2,6-7H2,3H3,(H,11,12) |
| InChIKey | MBDYQDHPWGBDHN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|