C6H10INO2 — CID 144974054
2-(iodoamino)ethyl 2-methylprop-2-enoate (PubChem CID 144974054) has the molecular formula C6H10INO2 and a molecular weight of 255.05 g/mol. Its IUPAC name is 2-(iodoamino)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(iodoamino)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 144974054 |
| Molecular Formula | C6H10INO2 |
| Molecular Weight | 255.05 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | 2-(iodoamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNI |
| InChI | InChI=1S/C6H10INO2/c1-5(2)6(9)10-4-3-8-7/h8H,1,3-4H2,2H3 |
| InChIKey | LIWVIMGTXCPKRU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.05 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|