C13H26N4O6 — CID 144635038
N-[2-[2-[2-[2-[(2-aminooxyacetyl)amino]ethylamino]-2-oxoethoxy]ethoxy]ethyl]propanamide (PubChem CID 144635038) has the molecular formula C13H26N4O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[(2-aminooxyacetyl)amino]ethylamino]-2-oxoethoxy]ethoxy]ethyl]propanamide.
| Compound Name | N-[2-[2-[2-[2-[(2-aminooxyacetyl)amino]ethylamino]-2-oxoethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 144635038 |
| Molecular Formula | C13H26N4O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-[2-[2-[2-[2-[(2-aminooxyacetyl)amino]ethylamino]-2-oxoethoxy]ethoxy]ethyl]propanamide |
| SMILES | CCC(=O)NCCOCCOCC(=O)NCCNC(=O)CON |
| InChI | InChI=1S/C13H26N4O6/c1-2-11(18)17-5-6-21-7-8-22-9-12(19)15-3-4-16-13(20)10-23-14/h2-10,14H2,1H3,(H,15,19)(H,16,20)(H,17,18) |
| InChIKey | ZZASDNUWKVKDIQ-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 141.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|