C24H46N4O10 — CID 137465988
N-[2-[2-[2-[2-[2-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxymethyl]propanamide (PubChem CID 137465988) has the molecular formula C24H46N4O10 and a molecular weight of 550.65 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[2-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxymethyl]propanamide.
| Compound Name | N-[2-[2-[2-[2-[2-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxymethyl]propanamide |
|---|---|
| PubChem CID | 137465988 |
| Molecular Formula | C24H46N4O10 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | N-[2-[2-[2-[2-[2-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxymethyl]propanamide |
| SMILES | CCCCNC(=O)COCCOCCNC(=O)COCCOCCNC(=O)COCCOCNC(=O)CC |
| InChI | InChI=1S/C24H46N4O10/c1-3-5-6-25-22(30)17-35-13-11-33-9-7-26-23(31)18-36-14-12-34-10-8-27-24(32)19-37-15-16-38-20-28-21(29)4-2/h3-20H2,1-2H3,(H,25,30)(H,26,31)(H,27,32)(H,28,29) |
| InChIKey | LZYZGKYSWPUOAT-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 171.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|