C23H45N3O7 — CID 89417865
N-[2-[2-[2-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethyl]heptanamide (PubChem CID 89417865) has the molecular formula C23H45N3O7 and a molecular weight of 475.63 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethyl]heptanamide.
| Compound Name | N-[2-[2-[2-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethyl]heptanamide |
|---|---|
| PubChem CID | 89417865 |
| Molecular Formula | C23H45N3O7 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.33 |
| IUPAC Name | N-[2-[2-[2-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethyl]heptanamide |
| SMILES | CCCCCCC(=O)NCCOCCOCC(=O)NCCOCCOCC(=O)NCCCC |
| InChI | InChI=1S/C23H45N3O7/c1-3-5-7-8-9-21(27)25-11-13-30-15-18-33-20-23(29)26-12-14-31-16-17-32-19-22(28)24-10-6-4-2/h3-20H2,1-2H3,(H,24,28)(H,25,27)(H,26,29) |
| InChIKey | BTLXBPNPIWLGBE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|