C16H31N3O5 — CID 123251408
4-[[2-[2-(2-acetamidoethoxy)ethoxy]acetyl]amino]-N-butylbutanamide (PubChem CID 123251408) has the molecular formula C16H31N3O5 and a molecular weight of 345.44 g/mol. Its IUPAC name is 4-[[2-[2-(2-acetamidoethoxy)ethoxy]acetyl]amino]-N-butylbutanamide.
| Compound Name | 4-[[2-[2-(2-acetamidoethoxy)ethoxy]acetyl]amino]-N-butylbutanamide |
|---|---|
| PubChem CID | 123251408 |
| Molecular Formula | C16H31N3O5 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 4-[[2-[2-(2-acetamidoethoxy)ethoxy]acetyl]amino]-N-butylbutanamide |
| SMILES | CCCCNC(=O)CCCNC(=O)COCCOCCNC(C)=O |
| InChI | InChI=1S/C16H31N3O5/c1-3-4-7-18-15(21)6-5-8-19-16(22)13-24-12-11-23-10-9-17-14(2)20/h3-13H2,1-2H3,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | XXKXCWBMMKGCCR-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|