C21H39N3O7 — CID 146625820
N-[2-[2-[2-oxo-2-[2-[2-[2-oxo-2-(pent-4-enylamino)ethoxy]ethoxy]ethylamino]ethoxy]ethoxy]ethyl]butanamide (PubChem CID 146625820) has the molecular formula C21H39N3O7 and a molecular weight of 445.56 g/mol. Its IUPAC name is N-[2-[2-[2-oxo-2-[2-[2-[2-oxo-2-(pent-4-enylamino)ethoxy]ethoxy]ethylamino]ethoxy]ethoxy]ethyl]butanamide.
| Compound Name | N-[2-[2-[2-oxo-2-[2-[2-[2-oxo-2-(pent-4-enylamino)ethoxy]ethoxy]ethylamino]ethoxy]ethoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 146625820 |
| Molecular Formula | C21H39N3O7 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | N-[2-[2-[2-oxo-2-[2-[2-[2-oxo-2-(pent-4-enylamino)ethoxy]ethoxy]ethylamino]ethoxy]ethoxy]ethyl]butanamide |
| SMILES | C=CCCCNC(=O)COCCOCCNC(=O)COCCOCCNC(=O)CCC |
| InChI | InChI=1S/C21H39N3O7/c1-3-5-6-8-22-20(26)17-30-15-14-29-12-10-24-21(27)18-31-16-13-28-11-9-23-19(25)7-4-2/h3H,1,4-18H2,2H3,(H,22,26)(H,23,25)(H,24,27) |
| InChIKey | OMVXJSPTGHVRBV-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|