About N-but-3-enylbutanamide
N-but-3-enylbutanamide (PubChem CID 54459050) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is N-but-3-enylbutanamide.
Molecular Properties
| Compound Name | N-but-3-enylbutanamide |
| PubChem CID | 54459050 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | N-but-3-enylbutanamide |
| SMILES | C=CCCNC(=O)CCC |
| InChI | InChI=1S/C8H15NO/c1-3-5-7-9-8(10)6-4-2/h3H,1,4-7H2,2H3,(H,9,10) |
| InChIKey | CIJBEGZGXCCAFX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-but-3-enylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-3-enylbutanamide?
The IUPAC name of N-but-3-enylbutanamide (CID 54459050) is N-but-3-enylbutanamide.
What is the SMILES notation for N-but-3-enylbutanamide?
The canonical SMILES for N-but-3-enylbutanamide is C=CCCNC(=O)CCC.
What is the InChIKey of N-but-3-enylbutanamide?
The InChIKey is CIJBEGZGXCCAFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO/c1-3-5-7-9-8(10)6-4-2/h3H,1,4-7H2,2H3,(H,9,10).
What are the key properties of N-but-3-enylbutanamide?
N-but-3-enylbutanamide has a molecular weight of 141.21 g/mol, XLogP of 1.48, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-3-enylbutanamide is sourced from PubChem (CID 54459050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).