About N-ethylbutanamide;methanimine
N-ethylbutanamide;methanimine (PubChem CID 142280316) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is N-ethylbutanamide;methanimine.
Molecular Properties
| Compound Name | N-ethylbutanamide;methanimine |
| PubChem CID | 142280316 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | N-ethylbutanamide;methanimine |
| SMILES | CCCC(=O)NCC.[H]N=C |
| InChI | InChI=1S/C6H13NO.CH3N/c1-3-5-6(8)7-4-2;1-2/h3-5H2,1-2H3,(H,7,8);2H,1H2 |
| InChIKey | VFPCBIXKJHMFCT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethylbutanamide;methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylbutanamide;methanimine?
The IUPAC name of N-ethylbutanamide;methanimine (CID 142280316) is N-ethylbutanamide;methanimine.
What is the SMILES notation for N-ethylbutanamide;methanimine?
The canonical SMILES for N-ethylbutanamide;methanimine is CCCC(=O)NCC.[H]N=C.
What is the InChIKey of N-ethylbutanamide;methanimine?
The InChIKey is VFPCBIXKJHMFCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.CH3N/c1-3-5-6(8)7-4-2;1-2/h3-5H2,1-2H3,(H,7,8);2H,1H2.
What are the key properties of N-ethylbutanamide;methanimine?
N-ethylbutanamide;methanimine has a molecular weight of 144.22 g/mol, XLogP of 1.19, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylbutanamide;methanimine is sourced from PubChem (CID 142280316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).