About N-ethyl-3-oxohexanamide
N-ethyl-3-oxohexanamide (PubChem CID 88638325) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is N-ethyl-3-oxohexanamide.
Molecular Properties
| Compound Name | N-ethyl-3-oxohexanamide |
| PubChem CID | 88638325 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | N-ethyl-3-oxohexanamide |
| SMILES | CCCC(=O)CC(=O)NCC |
| InChI | InChI=1S/C8H15NO2/c1-3-5-7(10)6-8(11)9-4-2/h3-6H2,1-2H3,(H,9,11) |
| InChIKey | PQHSIAJJIHIBHU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-3-oxohexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-oxohexanamide?
The IUPAC name of N-ethyl-3-oxohexanamide (CID 88638325) is N-ethyl-3-oxohexanamide.
What is the SMILES notation for N-ethyl-3-oxohexanamide?
The canonical SMILES for N-ethyl-3-oxohexanamide is CCCC(=O)CC(=O)NCC.
What is the InChIKey of N-ethyl-3-oxohexanamide?
The InChIKey is PQHSIAJJIHIBHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c1-3-5-7(10)6-8(11)9-4-2/h3-6H2,1-2H3,(H,9,11).
What are the key properties of N-ethyl-3-oxohexanamide?
N-ethyl-3-oxohexanamide has a molecular weight of 157.21 g/mol, XLogP of 0.88, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-oxohexanamide is sourced from PubChem (CID 88638325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).