About bis(heptane-2,4-dione);platinum
bis(heptane-2,4-dione);platinum (PubChem CID 158167242) has the molecular formula C14H24O4Pt
and a molecular weight of 451.42 g/mol. Its IUPAC name is bis(heptane-2,4-dione);platinum.
Molecular Properties
| Compound Name | bis(heptane-2,4-dione);platinum |
| PubChem CID | 158167242 |
| Molecular Formula | C14H24O4Pt |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | bis(heptane-2,4-dione);platinum |
| SMILES | CCCC(=O)CC(C)=O.CCCC(=O)CC(C)=O.[Pt] |
| InChI | InChI=1S/2C7H12O2.Pt/c2*1-3-4-7(9)5-6(2)8;/h2*3-5H2,1-2H3; |
| InChIKey | FWZODKRESLCDPZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(heptane-2,4-dione);platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(heptane-2,4-dione);platinum?
The IUPAC name of bis(heptane-2,4-dione);platinum (CID 158167242) is bis(heptane-2,4-dione);platinum.
What is the SMILES notation for bis(heptane-2,4-dione);platinum?
The canonical SMILES for bis(heptane-2,4-dione);platinum is CCCC(=O)CC(C)=O.CCCC(=O)CC(C)=O.[Pt].
What is the InChIKey of bis(heptane-2,4-dione);platinum?
The InChIKey is FWZODKRESLCDPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H12O2.Pt/c2*1-3-4-7(9)5-6(2)8;/h2*3-5H2,1-2H3;.
What are the key properties of bis(heptane-2,4-dione);platinum?
bis(heptane-2,4-dione);platinum has a molecular weight of 451.42 g/mol, XLogP of 2.67, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(heptane-2,4-dione);platinum is sourced from PubChem (CID 158167242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).