About heptane-2,4-dione;palladium(2+)
heptane-2,4-dione;palladium(2+) (PubChem CID 21417766) has the molecular formula C7H12O2Pd+2
and a molecular weight of 234.59 g/mol. Its IUPAC name is heptane-2,4-dione;palladium(2+).
Molecular Properties
| Compound Name | heptane-2,4-dione;palladium(2+) |
| PubChem CID | 21417766 |
| Molecular Formula | C7H12O2Pd+2 |
| Molecular Weight | 234.59 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | heptane-2,4-dione;palladium(2+) |
| SMILES | CCCC(=O)CC(C)=O.[Pd+2] |
| InChI | InChI=1S/C7H12O2.Pd/c1-3-4-7(9)5-6(2)8;/h3-5H2,1-2H3;/q;+2 |
| InChIKey | KEGUPQXAXABABP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.59 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze heptane-2,4-dione;palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptane-2,4-dione;palladium(2+)?
The IUPAC name of heptane-2,4-dione;palladium(2+) (CID 21417766) is heptane-2,4-dione;palladium(2+).
What is the SMILES notation for heptane-2,4-dione;palladium(2+)?
The canonical SMILES for heptane-2,4-dione;palladium(2+) is CCCC(=O)CC(C)=O.[Pd+2].
What is the InChIKey of heptane-2,4-dione;palladium(2+)?
The InChIKey is KEGUPQXAXABABP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.Pd/c1-3-4-7(9)5-6(2)8;/h3-5H2,1-2H3;/q;+2.
What are the key properties of heptane-2,4-dione;palladium(2+)?
heptane-2,4-dione;palladium(2+) has a molecular weight of 234.59 g/mol, XLogP of 1.33, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptane-2,4-dione;palladium(2+) is sourced from PubChem (CID 21417766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).