C14H23NaO4 — CID 174954679
sodium;hydride;tetradecane-2,5,8,11-tetrone (PubChem CID 174954679) has the molecular formula C14H23NaO4 and a molecular weight of 278.32 g/mol. Its IUPAC name is sodium;hydride;tetradecane-2,5,8,11-tetrone.
| Compound Name | sodium;hydride;tetradecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 174954679 |
| Molecular Formula | C14H23NaO4 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | sodium;hydride;tetradecane-2,5,8,11-tetrone |
| SMILES | CCCC(=O)CCC(=O)CCC(=O)CCC(C)=O.[H-].[Na+] |
| InChI | InChI=1S/C14H22O4.Na.H/c1-3-4-12(16)7-8-14(18)10-9-13(17)6-5-11(2)15;;/h3-10H2,1-2H3;;/q;+1;-1 |
| InChIKey | NGNYHDGCEJKNJC-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |