About palladium;pentan-2-one
palladium;pentan-2-one (PubChem CID 174766041) has the molecular formula C5H10OPd
and a molecular weight of 192.55 g/mol. Its IUPAC name is palladium;pentan-2-one.
Molecular Properties
| Compound Name | palladium;pentan-2-one |
| PubChem CID | 174766041 |
| Molecular Formula | C5H10OPd |
| Molecular Weight | 192.55 g/mol |
| Exact Mass | 191.98 |
| IUPAC Name | palladium;pentan-2-one |
| SMILES | CCCC(C)=O.[Pd] |
| InChI | InChI=1S/C5H10O.Pd/c1-3-4-5(2)6;/h3-4H2,1-2H3; |
| InChIKey | PQUIRTNFVWMBKD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.55 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze palladium;pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium;pentan-2-one?
The IUPAC name of palladium;pentan-2-one (CID 174766041) is palladium;pentan-2-one.
What is the SMILES notation for palladium;pentan-2-one?
The canonical SMILES for palladium;pentan-2-one is CCCC(C)=O.[Pd].
What is the InChIKey of palladium;pentan-2-one?
The InChIKey is PQUIRTNFVWMBKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.Pd/c1-3-4-5(2)6;/h3-4H2,1-2H3;.
What are the key properties of palladium;pentan-2-one?
palladium;pentan-2-one has a molecular weight of 192.55 g/mol, XLogP of 1.37, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for palladium;pentan-2-one is sourced from PubChem (CID 174766041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).