About pentan-2-one;propanoic acid
pentan-2-one;propanoic acid (PubChem CID 162011313) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is pentan-2-one;propanoic acid.
Molecular Properties
| Compound Name | pentan-2-one;propanoic acid |
| PubChem CID | 162011313 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | pentan-2-one;propanoic acid |
| SMILES | CCC(=O)O.CCCC(C)=O |
| InChI | InChI=1S/C5H10O.C3H6O2/c1-3-4-5(2)6;1-2-3(4)5/h3-4H2,1-2H3;2H2,1H3,(H,4,5) |
| InChIKey | YTMZWTNHZXTOHS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pentan-2-one;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-one;propanoic acid?
The IUPAC name of pentan-2-one;propanoic acid (CID 162011313) is pentan-2-one;propanoic acid.
What is the SMILES notation for pentan-2-one;propanoic acid?
The canonical SMILES for pentan-2-one;propanoic acid is CCC(=O)O.CCCC(C)=O.
What is the InChIKey of pentan-2-one;propanoic acid?
The InChIKey is YTMZWTNHZXTOHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.C3H6O2/c1-3-4-5(2)6;1-2-3(4)5/h3-4H2,1-2H3;2H2,1H3,(H,4,5).
What are the key properties of pentan-2-one;propanoic acid?
pentan-2-one;propanoic acid has a molecular weight of 160.21 g/mol, XLogP of 1.86, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-one;propanoic acid is sourced from PubChem (CID 162011313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).