About butane-2,3-dione;pentan-2-one
butane-2,3-dione;pentan-2-one (PubChem CID 160941626) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is butane-2,3-dione;pentan-2-one.
Molecular Properties
| Compound Name | butane-2,3-dione;pentan-2-one |
| PubChem CID | 160941626 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | butane-2,3-dione;pentan-2-one |
| SMILES | CC(=O)C(C)=O.CCCC(C)=O |
| InChI | InChI=1S/C5H10O.C4H6O2/c1-3-4-5(2)6;1-3(5)4(2)6/h3-4H2,1-2H3;1-2H3 |
| InChIKey | SUOUOZNWFFTNRV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze butane-2,3-dione;pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-2,3-dione;pentan-2-one?
The IUPAC name of butane-2,3-dione;pentan-2-one (CID 160941626) is butane-2,3-dione;pentan-2-one.
What is the SMILES notation for butane-2,3-dione;pentan-2-one?
The canonical SMILES for butane-2,3-dione;pentan-2-one is CC(=O)C(C)=O.CCCC(C)=O.
What is the InChIKey of butane-2,3-dione;pentan-2-one?
The InChIKey is SUOUOZNWFFTNRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.C4H6O2/c1-3-4-5(2)6;1-3(5)4(2)6/h3-4H2,1-2H3;1-2H3.
What are the key properties of butane-2,3-dione;pentan-2-one?
butane-2,3-dione;pentan-2-one has a molecular weight of 172.22 g/mol, XLogP of 1.54, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane-2,3-dione;pentan-2-one is sourced from PubChem (CID 160941626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).