About oxetane;pentan-2-one
oxetane;pentan-2-one (PubChem CID 159710624) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is oxetane;pentan-2-one.
Molecular Properties
| Compound Name | oxetane;pentan-2-one |
| PubChem CID | 159710624 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | oxetane;pentan-2-one |
| SMILES | C1COC1.CCCC(C)=O |
| InChI | InChI=1S/C5H10O.C3H6O/c1-3-4-5(2)6;1-2-4-3-1/h3-4H2,1-2H3;1-3H2 |
| InChIKey | MYUDXPDTDLCVRZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze oxetane;pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxetane;pentan-2-one?
The IUPAC name of oxetane;pentan-2-one (CID 159710624) is oxetane;pentan-2-one.
What is the SMILES notation for oxetane;pentan-2-one?
The canonical SMILES for oxetane;pentan-2-one is C1COC1.CCCC(C)=O.
What is the InChIKey of oxetane;pentan-2-one?
The InChIKey is MYUDXPDTDLCVRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.C3H6O/c1-3-4-5(2)6;1-2-4-3-1/h3-4H2,1-2H3;1-3H2.
What are the key properties of oxetane;pentan-2-one?
oxetane;pentan-2-one has a molecular weight of 144.21 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxetane;pentan-2-one is sourced from PubChem (CID 159710624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).