About octane-2,6-dione;oxolane
octane-2,6-dione;oxolane (PubChem CID 174943370) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is octane-2,6-dione;oxolane.
Molecular Properties
| Compound Name | octane-2,6-dione;oxolane |
| PubChem CID | 174943370 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | octane-2,6-dione;oxolane |
| SMILES | C1CCOC1.CCC(=O)CCCC(C)=O |
| InChI | InChI=1S/C8H14O2.C4H8O/c1-3-8(10)6-4-5-7(2)9;1-2-4-5-3-1/h3-6H2,1-2H3;1-4H2 |
| InChIKey | HSVWOIYXGJSHIF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze octane-2,6-dione;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octane-2,6-dione;oxolane?
The IUPAC name of octane-2,6-dione;oxolane (CID 174943370) is octane-2,6-dione;oxolane.
What is the SMILES notation for octane-2,6-dione;oxolane?
The canonical SMILES for octane-2,6-dione;oxolane is C1CCOC1.CCC(=O)CCCC(C)=O.
What is the InChIKey of octane-2,6-dione;oxolane?
The InChIKey is HSVWOIYXGJSHIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.C4H8O/c1-3-8(10)6-4-5-7(2)9;1-2-4-5-3-1/h3-6H2,1-2H3;1-4H2.
What are the key properties of octane-2,6-dione;oxolane?
octane-2,6-dione;oxolane has a molecular weight of 214.30 g/mol, XLogP of 2.52, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octane-2,6-dione;oxolane is sourced from PubChem (CID 174943370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).