About pentan-2-one;zinc
pentan-2-one;zinc (PubChem CID 88629307) has the molecular formula C5H10OZn
and a molecular weight of 151.52 g/mol. Its IUPAC name is pentan-2-one;zinc.
Molecular Properties
| Compound Name | pentan-2-one;zinc |
| PubChem CID | 88629307 |
| Molecular Formula | C5H10OZn |
| Molecular Weight | 151.52 g/mol |
| Exact Mass | 150.00 |
| IUPAC Name | pentan-2-one;zinc |
| SMILES | CCCC(C)=O.[Zn] |
| InChI | InChI=1S/C5H10O.Zn/c1-3-4-5(2)6;/h3-4H2,1-2H3; |
| InChIKey | DLPBAUHVXQMEPB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.52 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze pentan-2-one;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-one;zinc?
The IUPAC name of pentan-2-one;zinc (CID 88629307) is pentan-2-one;zinc.
What is the SMILES notation for pentan-2-one;zinc?
The canonical SMILES for pentan-2-one;zinc is CCCC(C)=O.[Zn].
What is the InChIKey of pentan-2-one;zinc?
The InChIKey is DLPBAUHVXQMEPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.Zn/c1-3-4-5(2)6;/h3-4H2,1-2H3;.
What are the key properties of pentan-2-one;zinc?
pentan-2-one;zinc has a molecular weight of 151.52 g/mol, XLogP of 1.37, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-one;zinc is sourced from PubChem (CID 88629307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).