About acetic acid;butanoic acid
acetic acid;butanoic acid (PubChem CID 87533224) has the molecular formula C10H20O6
and a molecular weight of 236.26 g/mol. Its IUPAC name is acetic acid;butanoic acid.
Molecular Properties
| Compound Name | acetic acid;butanoic acid |
| PubChem CID | 87533224 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | acetic acid;butanoic acid |
| SMILES | CC(=O)O.CCCC(=O)O.CCCC(=O)O |
| InChI | InChI=1S/2C4H8O2.C2H4O2/c2*1-2-3-4(5)6;1-2(3)4/h2*2-3H2,1H3,(H,5,6);1H3,(H,3,4) |
| InChIKey | BTVGHQASHWCGHI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetic acid;butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;butanoic acid?
The IUPAC name of acetic acid;butanoic acid (CID 87533224) is acetic acid;butanoic acid.
What is the SMILES notation for acetic acid;butanoic acid?
The canonical SMILES for acetic acid;butanoic acid is CC(=O)O.CCCC(=O)O.CCCC(=O)O.
What is the InChIKey of acetic acid;butanoic acid?
The InChIKey is BTVGHQASHWCGHI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H8O2.C2H4O2/c2*1-2-3-4(5)6;1-2(3)4/h2*2-3H2,1H3,(H,5,6);1H3,(H,3,4).
What are the key properties of acetic acid;butanoic acid?
acetic acid;butanoic acid has a molecular weight of 236.26 g/mol, XLogP of 1.83, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;butanoic acid is sourced from PubChem (CID 87533224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).